C21H22N4O2S3 — CID 40827780
2-benzylsulfanyl-N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 40827780) has the molecular formula C21H22N4O2S3 and a molecular weight of 458.63 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-benzylsulfanyl-N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 40827780 |
| Molecular Formula | C21H22N4O2S3 |
| Molecular Weight | 458.63 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | 2-benzylsulfanyl-N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | Cc1cccc(NC(=O)CSc2nnc(NC(=O)CSCc3ccccc3)s2)c1C |
| InChI | InChI=1S/C21H22N4O2S3/c1-14-7-6-10-17(15(14)2)22-19(27)13-29-21-25-24-20(30-21)23-18(26)12-28-11-16-8-4-3-5-9-16/h3-10H,11-13H2,1-2H3,(H,22,27)(H,23,24,26) |
| InChIKey | QXNSFVUBTLMLCC-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.63 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|