C22H24N4O2S3 — CID 56766170
N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 56766170) has the molecular formula C22H24N4O2S3 and a molecular weight of 472.66 g/mol. Its IUPAC name is N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 56766170 |
| Molecular Formula | C22H24N4O2S3 |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 472.11 |
| IUPAC Name | N-[5-[2-(2,3-dimethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | Cc1cccc(NC(=O)CSc2nnc(NC(=O)C3(c4cccs4)CCCC3)s2)c1C |
| InChI | InChI=1S/C22H24N4O2S3/c1-14-7-5-8-16(15(14)2)23-18(27)13-30-21-26-25-20(31-21)24-19(28)22(10-3-4-11-22)17-9-6-12-29-17/h5-9,12H,3-4,10-11,13H2,1-2H3,(H,23,27)(H,24,25,28) |
| InChIKey | HTTVFRKURBYBDP-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|