C20H26N4O2S3 — CID 121029882
N-[5-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 121029882) has the molecular formula C20H26N4O2S3 and a molecular weight of 450.66 g/mol. Its IUPAC name is N-[5-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[5-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121029882 |
| Molecular Formula | C20H26N4O2S3 |
| Molecular Weight | 450.66 g/mol |
| Exact Mass | 450.12 |
| IUPAC Name | N-[5-[2-(azepan-1-yl)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)C2(c3cccs3)CCCC2)s1)N1CCCCCC1 |
| InChI | InChI=1S/C20H26N4O2S3/c25-16(24-11-5-1-2-6-12-24)14-28-19-23-22-18(29-19)21-17(26)20(9-3-4-10-20)15-8-7-13-27-15/h7-8,13H,1-6,9-12,14H2,(H,21,22,26) |
| InChIKey | FCCNEPKMWPMGOC-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.66 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|