C21H19F3N4O3S3 — CID 121029924
N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide (PubChem CID 121029924) has the molecular formula C21H19F3N4O3S3 and a molecular weight of 528.60 g/mol. Its IUPAC name is N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide.
| Compound Name | N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 121029924 |
| Molecular Formula | C21H19F3N4O3S3 |
| Molecular Weight | 528.60 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-1-thiophen-2-ylcyclopentane-1-carboxamide |
| SMILES | O=C(CSc1nnc(NC(=O)C2(c3cccs3)CCCC2)s1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C21H19F3N4O3S3/c22-21(23,24)31-14-7-5-13(6-8-14)25-16(29)12-33-19-28-27-18(34-19)26-17(30)20(9-1-2-10-20)15-4-3-11-32-15/h3-8,11H,1-2,9-10,12H2,(H,25,29)(H,26,27,30) |
| InChIKey | MUVYPXMFZMHDLD-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.60 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|