C21H19F3N4O5S2 — CID 44956454
2-(3,4-dimethoxyphenyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide (PubChem CID 44956454) has the molecular formula C21H19F3N4O5S2 and a molecular weight of 528.53 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide.
| Compound Name | 2-(3,4-dimethoxyphenyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 44956454 |
| Molecular Formula | C21H19F3N4O5S2 |
| Molecular Weight | 528.53 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-N-[5-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]acetamide |
| SMILES | COc1ccc(CC(=O)Nc2nnc(SCC(=O)Nc3ccc(OC(F)(F)F)cc3)s2)cc1OC |
| InChI | InChI=1S/C21H19F3N4O5S2/c1-31-15-8-3-12(9-16(15)32-2)10-17(29)26-19-27-28-20(35-19)34-11-18(30)25-13-4-6-14(7-5-13)33-21(22,23)24/h3-9H,10-11H2,1-2H3,(H,25,30)(H,26,27,29) |
| InChIKey | NLLIFDFBGLXIES-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.53 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|