C23H24N4O4S2 — CID 40832595
(E)-3-(3,4-dimethoxyphenyl)-N-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide (PubChem CID 40832595) has the molecular formula C23H24N4O4S2 and a molecular weight of 484.60 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 40832595 |
| Molecular Formula | C23H24N4O4S2 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.12 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[5-[2-(4-ethylanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]prop-2-enamide |
| SMILES | CCc1ccc(NC(=O)CSc2nnc(NC(=O)/C=C/c3ccc(OC)c(OC)c3)s2)cc1 |
| InChI | InChI=1S/C23H24N4O4S2/c1-4-15-5-9-17(10-6-15)24-21(29)14-32-23-27-26-22(33-23)25-20(28)12-8-16-7-11-18(30-2)19(13-16)31-3/h5-13H,4,14H2,1-3H3,(H,24,29)(H,25,26,28)/b12-8+ |
| InChIKey | RPKNZUNVCYDYMG-XYOKQWHBSA-N |
| XLogP | 4.50 |
| TPSA | 102.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|