C23H23ClN4O6S2 — CID 44956528
(E)-N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide (PubChem CID 44956528) has the molecular formula C23H23ClN4O6S2 and a molecular weight of 551.05 g/mol. Its IUPAC name is (E)-N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 44956528 |
| Molecular Formula | C23H23ClN4O6S2 |
| Molecular Weight | 551.05 g/mol |
| Exact Mass | 550.07 |
| IUPAC Name | (E)-N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-3-(3,4,5-trimethoxyphenyl)prop-2-enamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nnc(NC(=O)/C=C/c2cc(OC)c(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C23H23ClN4O6S2/c1-31-16-7-6-14(24)11-15(16)25-20(30)12-35-23-28-27-22(36-23)26-19(29)8-5-13-9-17(32-2)21(34-4)18(10-13)33-3/h5-11H,12H2,1-4H3,(H,25,30)(H,26,27,29)/b8-5+ |
| InChIKey | CBHZCVHXDLKGDC-VMPITWQZSA-N |
| XLogP | 4.61 |
| TPSA | 120.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.05 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|