C20H19ClN4O5S2 — CID 40833094
5-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide (PubChem CID 40833094) has the molecular formula C20H19ClN4O5S2 and a molecular weight of 494.98 g/mol. Its IUPAC name is 5-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 40833094 |
| Molecular Formula | C20H19ClN4O5S2 |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.05 |
| IUPAC Name | 5-chloro-N-[5-[2-(2,5-dimethoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(OC)c(NC(=O)CSc2nnc(NC(=O)c3cc(Cl)ccc3OC)s2)c1 |
| InChI | InChI=1S/C20H19ClN4O5S2/c1-28-12-5-7-16(30-3)14(9-12)22-17(26)10-31-20-25-24-19(32-20)23-18(27)13-8-11(21)4-6-15(13)29-2/h4-9H,10H2,1-3H3,(H,22,26)(H,23,24,27) |
| InChIKey | IWZNSYZKXUNICB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 111.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|