C19H18ClN5O4S2 — CID 16538800
5-chloro-2-methoxy-N'-[2-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide (PubChem CID 16538800) has the molecular formula C19H18ClN5O4S2 and a molecular weight of 479.97 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-[2-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-[2-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 16538800 |
| Molecular Formula | C19H18ClN5O4S2 |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.05 |
| IUPAC Name | 5-chloro-2-methoxy-N'-[2-[[5-(4-methoxyanilino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetyl]benzohydrazide |
| SMILES | COc1ccc(Nc2nnc(SCC(=O)NNC(=O)c3cc(Cl)ccc3OC)s2)cc1 |
| InChI | InChI=1S/C19H18ClN5O4S2/c1-28-13-6-4-12(5-7-13)21-18-24-25-19(31-18)30-10-16(26)22-23-17(27)14-9-11(20)3-8-15(14)29-2/h3-9H,10H2,1-2H3,(H,21,24)(H,22,26)(H,23,27) |
| InChIKey | ATPFZDUSSNXUGA-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 114.47 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|