C23H21ClN6O3S3 — CID 3469392
5-chloro-2-methoxy-N-[5-[2-oxo-2-[[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide (PubChem CID 3469392) has the molecular formula C23H21ClN6O3S3 and a molecular weight of 561.11 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N-[5-[2-oxo-2-[[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide.
| Compound Name | 5-chloro-2-methoxy-N-[5-[2-oxo-2-[[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 3469392 |
| Molecular Formula | C23H21ClN6O3S3 |
| Molecular Weight | 561.11 g/mol |
| Exact Mass | 560.05 |
| IUPAC Name | 5-chloro-2-methoxy-N-[5-[2-oxo-2-[[5-(2,4,6-trimethylphenyl)-1,3,4-thiadiazol-2-yl]amino]ethyl]sulfanyl-1,3,4-thiadiazol-2-yl]benzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1nnc(SCC(=O)Nc2nnc(-c3c(C)cc(C)cc3C)s2)s1 |
| InChI | InChI=1S/C23H21ClN6O3S3/c1-11-7-12(2)18(13(3)8-11)20-27-28-21(35-20)25-17(31)10-34-23-30-29-22(36-23)26-19(32)15-9-14(24)5-6-16(15)33-4/h5-9H,10H2,1-4H3,(H,25,28,31)(H,26,29,32) |
| InChIKey | UMHZEUGJZVMODA-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 118.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.11 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|