C18H13Cl3N4O3S2 — CID 44956753
5-chloro-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide (PubChem CID 44956753) has the molecular formula C18H13Cl3N4O3S2 and a molecular weight of 503.82 g/mol. Its IUPAC name is 5-chloro-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide.
| Compound Name | 5-chloro-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 44956753 |
| Molecular Formula | C18H13Cl3N4O3S2 |
| Molecular Weight | 503.82 g/mol |
| Exact Mass | 501.95 |
| IUPAC Name | 5-chloro-N-[5-[2-(3,4-dichloroanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methoxybenzamide |
| SMILES | COc1ccc(Cl)cc1C(=O)Nc1nnc(SCC(=O)Nc2ccc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C18H13Cl3N4O3S2/c1-28-14-5-2-9(19)6-11(14)16(27)23-17-24-25-18(30-17)29-8-15(26)22-10-3-4-12(20)13(21)7-10/h2-7H,8H2,1H3,(H,22,26)(H,23,24,27) |
| InChIKey | LYHXUJAWAYLFAT-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.82 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|