C15H17ClN4O3S2 — CID 7940124
N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide (PubChem CID 7940124) has the molecular formula C15H17ClN4O3S2 and a molecular weight of 400.91 g/mol. Its IUPAC name is N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide.
| Compound Name | N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
|---|---|
| PubChem CID | 7940124 |
| Molecular Formula | C15H17ClN4O3S2 |
| Molecular Weight | 400.91 g/mol |
| Exact Mass | 400.04 |
| IUPAC Name | N-[5-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-2-methylpropanamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CSc1nnc(NC(=O)C(C)C)s1 |
| InChI | InChI=1S/C15H17ClN4O3S2/c1-8(2)13(22)18-14-19-20-15(25-14)24-7-12(21)17-10-6-9(16)4-5-11(10)23-3/h4-6,8H,7H2,1-3H3,(H,17,21)(H,18,19,22) |
| InChIKey | LOQQJXCAMLDJBM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 93.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.91 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|