C18H17ClN6O4S — CID 16539064
5-chloro-2-methoxy-N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide (PubChem CID 16539064) has the molecular formula C18H17ClN6O4S and a molecular weight of 448.89 g/mol. Its IUPAC name is 5-chloro-2-methoxy-N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide.
| Compound Name | 5-chloro-2-methoxy-N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 16539064 |
| Molecular Formula | C18H17ClN6O4S |
| Molecular Weight | 448.89 g/mol |
| Exact Mass | 448.07 |
| IUPAC Name | 5-chloro-2-methoxy-N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)NNC(=O)c2cc(Cl)ccc2OC)cc1 |
| InChI | InChI=1S/C18H17ClN6O4S/c1-28-13-6-4-12(5-7-13)25-18(22-23-24-25)30-10-16(26)20-21-17(27)14-9-11(19)3-8-15(14)29-2/h3-9H,10H2,1-2H3,(H,20,26)(H,21,27) |
| InChIKey | VZZXIWYXFGAGBJ-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 120.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.89 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|