C19H20N6O3S2 — CID 18874171
N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide (PubChem CID 18874171) has the molecular formula C19H20N6O3S2 and a molecular weight of 444.54 g/mol. Its IUPAC name is N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide.
| Compound Name | N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide |
|---|---|
| PubChem CID | 18874171 |
| Molecular Formula | C19H20N6O3S2 |
| Molecular Weight | 444.54 g/mol |
| Exact Mass | 444.10 |
| IUPAC Name | N'-[2-[1-(4-methoxyphenyl)tetrazol-5-yl]sulfanylacetyl]-4,5,6,7-tetrahydro-1-benzothiophene-3-carbohydrazide |
| SMILES | COc1ccc(-n2nnnc2SCC(=O)NNC(=O)c2csc3c2CCCC3)cc1 |
| InChI | InChI=1S/C19H20N6O3S2/c1-28-13-8-6-12(7-9-13)25-19(22-23-24-25)30-11-17(26)20-21-18(27)15-10-29-16-5-3-2-4-14(15)16/h6-10H,2-5,11H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | YNNBVOZRWYCNBP-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.54 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|