C13H16N6O3S — CID 864277
N'-[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]-4-methoxybenzohydrazide (PubChem CID 864277) has the molecular formula C13H16N6O3S and a molecular weight of 336.38 g/mol. Its IUPAC name is N'-[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]-4-methoxybenzohydrazide.
| Compound Name | N'-[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]-4-methoxybenzohydrazide |
|---|---|
| PubChem CID | 864277 |
| Molecular Formula | C13H16N6O3S |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.10 |
| IUPAC Name | N'-[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]-4-methoxybenzohydrazide |
| SMILES | CCn1nnnc1SCC(=O)NNC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H16N6O3S/c1-3-19-13(16-17-18-19)23-8-11(20)14-15-12(21)9-4-6-10(22-2)7-5-9/h4-7H,3,8H2,1-2H3,(H,14,20)(H,15,21) |
| InChIKey | AZECSXPCYVZGCP-UHFFFAOYSA-N |
| XLogP | 0.25 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|