C18H17ClN6O3S — CID 26387767
4-chloro-N'-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetyl]benzohydrazide (PubChem CID 26387767) has the molecular formula C18H17ClN6O3S and a molecular weight of 432.89 g/mol. Its IUPAC name is 4-chloro-N'-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
|---|---|
| PubChem CID | 26387767 |
| Molecular Formula | C18H17ClN6O3S |
| Molecular Weight | 432.89 g/mol |
| Exact Mass | 432.08 |
| IUPAC Name | 4-chloro-N'-[2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetyl]benzohydrazide |
| SMILES | COc1ccc(Cn2nnnc2SCC(=O)NNC(=O)c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C18H17ClN6O3S/c1-28-15-8-2-12(3-9-15)10-25-18(22-23-24-25)29-11-16(26)20-21-17(27)13-4-6-14(19)7-5-13/h2-9H,10-11H2,1H3,(H,20,26)(H,21,27) |
| InChIKey | XWJHFWZUUMKZKS-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 111.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.89 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|