C18H18FN5O2S — CID 27091861
N-[(4-fluorophenyl)methyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetamide (PubChem CID 27091861) has the molecular formula C18H18FN5O2S and a molecular weight of 387.44 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 27091861 |
| Molecular Formula | C18H18FN5O2S |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2-[1-[(4-methoxyphenyl)methyl]tetrazol-5-yl]sulfanylacetamide |
| SMILES | COc1ccc(Cn2nnnc2SCC(=O)NCc2ccc(F)cc2)cc1 |
| InChI | InChI=1S/C18H18FN5O2S/c1-26-16-8-4-14(5-9-16)11-24-18(21-22-23-24)27-12-17(25)20-10-13-2-6-15(19)7-3-13/h2-9H,10-12H2,1H3,(H,20,25) |
| InChIKey | TXDHKJZARVKRSY-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |