C13H16N4O3S — CID 3212975
2-[1-(2-methoxyethyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)ethanone (PubChem CID 3212975) has the molecular formula C13H16N4O3S and a molecular weight of 308.36 g/mol. Its IUPAC name is 2-[1-(2-methoxyethyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)ethanone.
| Compound Name | 2-[1-(2-methoxyethyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 3212975 |
| Molecular Formula | C13H16N4O3S |
| Molecular Weight | 308.36 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 2-[1-(2-methoxyethyl)tetrazol-5-yl]sulfanyl-1-(4-methoxyphenyl)ethanone |
| SMILES | COCCn1nnnc1SCC(=O)c1ccc(OC)cc1 |
| InChI | InChI=1S/C13H16N4O3S/c1-19-8-7-17-13(14-15-16-17)21-9-12(18)10-3-5-11(20-2)6-4-10/h3-6H,7-9H2,1-2H3 |
| InChIKey | FNEGIGQOSSIRJF-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 79.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |