C15H14N4O3S — CID 17481501
2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-1-(3-methoxyphenyl)ethanone (PubChem CID 17481501) has the molecular formula C15H14N4O3S and a molecular weight of 330.37 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-1-(3-methoxyphenyl)ethanone.
| Compound Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-1-(3-methoxyphenyl)ethanone |
|---|---|
| PubChem CID | 17481501 |
| Molecular Formula | C15H14N4O3S |
| Molecular Weight | 330.37 g/mol |
| Exact Mass | 330.08 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-1-(3-methoxyphenyl)ethanone |
| SMILES | COc1cccc(C(=O)CSc2nnnn2Cc2ccco2)c1 |
| InChI | InChI=1S/C15H14N4O3S/c1-21-12-5-2-4-11(8-12)14(20)10-23-15-16-17-18-19(15)9-13-6-3-7-22-13/h2-8H,9-10H2,1H3 |
| InChIKey | WRQIWDCSRSVJJL-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |