C12H16N4O3S — CID 47138505
butyl 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetate (PubChem CID 47138505) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is butyl 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetate.
| Compound Name | butyl 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetate |
|---|---|
| PubChem CID | 47138505 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | butyl 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetate |
| SMILES | CCCCOC(=O)CSc1nnnn1Cc1ccco1 |
| InChI | InChI=1S/C12H16N4O3S/c1-2-3-6-19-11(17)9-20-12-13-14-15-16(12)8-10-5-4-7-18-10/h4-5,7H,2-3,6,8-9H2,1H3 |
| InChIKey | CRKXJRXXPHDSFZ-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|