C15H15N5O2S2 — CID 18140670
2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-methylsulfanylphenyl)acetamide (PubChem CID 18140670) has the molecular formula C15H15N5O2S2 and a molecular weight of 361.45 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-methylsulfanylphenyl)acetamide.
| Compound Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-methylsulfanylphenyl)acetamide |
|---|---|
| PubChem CID | 18140670 |
| Molecular Formula | C15H15N5O2S2 |
| Molecular Weight | 361.45 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-methylsulfanylphenyl)acetamide |
| SMILES | CSc1ccccc1NC(=O)CSc1nnnn1Cc1ccco1 |
| InChI | InChI=1S/C15H15N5O2S2/c1-23-13-7-3-2-6-12(13)16-14(21)10-24-15-17-18-19-20(15)9-11-5-4-8-22-11/h2-8H,9-10H2,1H3,(H,16,21) |
| InChIKey | BQBYKBUJFPROCN-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.45 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |