C15H21N5O2S — CID 42140432
N-cycloheptyl-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 42140432) has the molecular formula C15H21N5O2S and a molecular weight of 335.43 g/mol. Its IUPAC name is N-cycloheptyl-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-cycloheptyl-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 42140432 |
| Molecular Formula | C15H21N5O2S |
| Molecular Weight | 335.43 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | N-cycloheptyl-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1Cc1ccco1)NC1CCCCCC1 |
| InChI | InChI=1S/C15H21N5O2S/c21-14(16-12-6-3-1-2-4-7-12)11-23-15-17-18-19-20(15)10-13-8-5-9-22-13/h5,8-9,12H,1-4,6-7,10-11H2,(H,16,21) |
| InChIKey | CXDRHGCLBDJDAY-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |