C14H12ClN5O2S — CID 18140636
N-(2-chlorophenyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 18140636) has the molecular formula C14H12ClN5O2S and a molecular weight of 349.80 g/mol. Its IUPAC name is N-(2-chlorophenyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(2-chlorophenyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 18140636 |
| Molecular Formula | C14H12ClN5O2S |
| Molecular Weight | 349.80 g/mol |
| Exact Mass | 349.04 |
| IUPAC Name | N-(2-chlorophenyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1Cc1ccco1)Nc1ccccc1Cl |
| InChI | InChI=1S/C14H12ClN5O2S/c15-11-5-1-2-6-12(11)16-13(21)9-23-14-17-18-19-20(14)8-10-4-3-7-22-10/h1-7H,8-9H2,(H,16,21) |
| InChIKey | JVWSNIQSUSETLI-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.80 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |