C14H12N6O4S — CID 55498993
2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-nitrophenyl)acetamide (PubChem CID 55498993) has the molecular formula C14H12N6O4S and a molecular weight of 360.36 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-nitrophenyl)acetamide.
| Compound Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 55498993 |
| Molecular Formula | C14H12N6O4S |
| Molecular Weight | 360.36 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-nitrophenyl)acetamide |
| SMILES | O=C(CSc1nnnn1Cc1ccco1)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H12N6O4S/c21-13(15-11-5-1-2-6-12(11)20(22)23)9-25-14-16-17-18-19(14)8-10-4-3-7-24-10/h1-7H,8-9H2,(H,15,21) |
| InChIKey | FHOROLTUOJGLOH-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 128.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|