C13H11ClN6O2S — CID 46693836
N-(5-chloro-2-pyridinyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 46693836) has the molecular formula C13H11ClN6O2S and a molecular weight of 350.79 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46693836 |
| Molecular Formula | C13H11ClN6O2S |
| Molecular Weight | 350.79 g/mol |
| Exact Mass | 350.04 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1Cc1ccco1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H11ClN6O2S/c14-9-3-4-11(15-6-9)16-12(21)8-23-13-17-18-19-20(13)7-10-2-1-5-22-10/h1-6H,7-8H2,(H,15,16,21) |
| InChIKey | AUCYSQYKBYUVPV-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 98.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.79 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |