C13H11ClN6OS2 — CID 51244515
N-(5-chloro-2-pyridinyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 51244515) has the molecular formula C13H11ClN6OS2 and a molecular weight of 366.86 g/mol. Its IUPAC name is N-(5-chloro-2-pyridinyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(5-chloro-2-pyridinyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 51244515 |
| Molecular Formula | C13H11ClN6OS2 |
| Molecular Weight | 366.86 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | N-(5-chloro-2-pyridinyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nnnn1Cc1cccs1)Nc1ccc(Cl)cn1 |
| InChI | InChI=1S/C13H11ClN6OS2/c14-9-3-4-11(15-6-9)16-12(21)8-23-13-17-18-19-20(13)7-10-2-1-5-22-10/h1-6H,7-8H2,(H,15,16,21) |
| InChIKey | YFWGGVXEPQBGBP-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 85.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.86 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |