C16H15N5O2S2 — CID 36987490
N-[4-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]phenyl]acetamide (PubChem CID 36987490) has the molecular formula C16H15N5O2S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is N-[4-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]phenyl]acetamide.
| Compound Name | N-[4-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]phenyl]acetamide |
|---|---|
| PubChem CID | 36987490 |
| Molecular Formula | C16H15N5O2S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.07 |
| IUPAC Name | N-[4-[2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(C(=O)CSc2nnnn2Cc2cccs2)cc1 |
| InChI | InChI=1S/C16H15N5O2S2/c1-11(22)17-13-6-4-12(5-7-13)15(23)10-25-16-18-19-20-21(16)9-14-3-2-8-24-14/h2-8H,9-10H2,1H3,(H,17,22) |
| InChIKey | NMAQQRZULDYWNR-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |