C12H16N6O2S2 — CID 36987439
N-(propan-2-ylcarbamoyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide (PubChem CID 36987439) has the molecular formula C12H16N6O2S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is N-(propan-2-ylcarbamoyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-(propan-2-ylcarbamoyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 36987439 |
| Molecular Formula | C12H16N6O2S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.08 |
| IUPAC Name | N-(propan-2-ylcarbamoyl)-2-[1-(thiophen-2-ylmethyl)tetrazol-5-yl]sulfanylacetamide |
| SMILES | CC(C)NC(=O)NC(=O)CSc1nnnn1Cc1cccs1 |
| InChI | InChI=1S/C12H16N6O2S2/c1-8(2)13-11(20)14-10(19)7-22-12-15-16-17-18(12)6-9-4-3-5-21-9/h3-5,8H,6-7H2,1-2H3,(H2,13,14,19,20) |
| InChIKey | OZZUCIXGCZPEDO-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |