C15H16N6O3S2 — CID 55498202
2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide (PubChem CID 55498202) has the molecular formula C15H16N6O3S2 and a molecular weight of 392.47 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide.
| Compound Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
|---|---|
| PubChem CID | 55498202 |
| Molecular Formula | C15H16N6O3S2 |
| Molecular Weight | 392.47 g/mol |
| Exact Mass | 392.07 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-(2-thiophen-2-ylethylcarbamoyl)acetamide |
| SMILES | O=C(CSc1nnnn1Cc1ccco1)NC(=O)NCCc1cccs1 |
| InChI | InChI=1S/C15H16N6O3S2/c22-13(17-14(23)16-6-5-12-4-2-8-25-12)10-26-15-18-19-20-21(15)9-11-3-1-7-24-11/h1-4,7-8H,5-6,9-10H2,(H2,16,17,22,23) |
| InChIKey | DGDDNRQODVHEAZ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.47 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |