C19H23N5O2S — CID 18140848
2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-[2-(4-propan-2-ylphenyl)ethyl]acetamide (PubChem CID 18140848) has the molecular formula C19H23N5O2S and a molecular weight of 385.49 g/mol. Its IUPAC name is 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-[2-(4-propan-2-ylphenyl)ethyl]acetamide.
| Compound Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-[2-(4-propan-2-ylphenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 18140848 |
| Molecular Formula | C19H23N5O2S |
| Molecular Weight | 385.49 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2-[1-(furan-2-ylmethyl)tetrazol-5-yl]sulfanyl-N-[2-(4-propan-2-ylphenyl)ethyl]acetamide |
| SMILES | CC(C)c1ccc(CCNC(=O)CSc2nnnn2Cc2ccco2)cc1 |
| InChI | InChI=1S/C19H23N5O2S/c1-14(2)16-7-5-15(6-8-16)9-10-20-18(25)13-27-19-21-22-23-24(19)12-17-4-3-11-26-17/h3-8,11,14H,9-10,12-13H2,1-2H3,(H,20,25) |
| InChIKey | ZRIKSRSCBNVFEF-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 85.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.49 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |