C10H17N5OS — CID 1452223
N-cyclopentyl-2-(1-ethyltetrazol-5-yl)sulfanylacetamide (PubChem CID 1452223) has the molecular formula C10H17N5OS and a molecular weight of 255.35 g/mol. Its IUPAC name is N-cyclopentyl-2-(1-ethyltetrazol-5-yl)sulfanylacetamide.
| Compound Name | N-cyclopentyl-2-(1-ethyltetrazol-5-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 1452223 |
| Molecular Formula | C10H17N5OS |
| Molecular Weight | 255.35 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | N-cyclopentyl-2-(1-ethyltetrazol-5-yl)sulfanylacetamide |
| SMILES | CCn1nnnc1SCC(=O)NC1CCCC1 |
| InChI | InChI=1S/C10H17N5OS/c1-2-15-10(12-13-14-15)17-7-9(16)11-8-5-3-4-6-8/h8H,2-7H2,1H3,(H,11,16) |
| InChIKey | FYTIGBUIMRVESQ-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 72.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.35 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |