C18H20N4O3S — CID 78764606
butyl 2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetate (PubChem CID 78764606) has the molecular formula C18H20N4O3S and a molecular weight of 372.45 g/mol. Its IUPAC name is butyl 2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetate.
| Compound Name | butyl 2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetate |
|---|---|
| PubChem CID | 78764606 |
| Molecular Formula | C18H20N4O3S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | butyl 2-[[4-(furan-2-ylmethyl)-5-pyridin-3-yl-1,2,4-triazol-3-yl]sulfanyl]acetate |
| SMILES | CCCCOC(=O)CSc1nnc(-c2cccnc2)n1Cc1ccco1 |
| InChI | InChI=1S/C18H20N4O3S/c1-2-3-9-25-16(23)13-26-18-21-20-17(14-6-4-8-19-11-14)22(18)12-15-7-5-10-24-15/h4-8,10-11H,2-3,9,12-13H2,1H3 |
| InChIKey | SDMQYBSZGKKGPX-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 83.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|