C12H15N5O2S — CID 864272
2-(1-ethyltetrazol-5-yl)sulfanyl-N-(2-methoxyphenyl)acetamide (PubChem CID 864272) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-(1-ethyltetrazol-5-yl)sulfanyl-N-(2-methoxyphenyl)acetamide.
| Compound Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-N-(2-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 864272 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-(1-ethyltetrazol-5-yl)sulfanyl-N-(2-methoxyphenyl)acetamide |
| SMILES | CCn1nnnc1SCC(=O)Nc1ccccc1OC |
| InChI | InChI=1S/C12H15N5O2S/c1-3-17-12(14-15-16-17)20-8-11(18)13-9-6-4-5-7-10(9)19-2/h4-7H,3,8H2,1-2H3,(H,13,18) |
| InChIKey | YZOMMVVGPDAMNK-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 81.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |