C14H18N6O2S — CID 3169643
N-[3-[[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide (PubChem CID 3169643) has the molecular formula C14H18N6O2S and a molecular weight of 334.41 g/mol. Its IUPAC name is N-[3-[[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide.
| Compound Name | N-[3-[[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 3169643 |
| Molecular Formula | C14H18N6O2S |
| Molecular Weight | 334.41 g/mol |
| Exact Mass | 334.12 |
| IUPAC Name | N-[3-[[2-(1-ethyltetrazol-5-yl)sulfanylacetyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CSc2nnnn2CC)c1 |
| InChI | InChI=1S/C14H18N6O2S/c1-3-12(21)15-10-6-5-7-11(8-10)16-13(22)9-23-14-17-18-19-20(14)4-2/h5-8H,3-4,9H2,1-2H3,(H,15,21)(H,16,22) |
| InChIKey | ZGQBDJKYBPGYER-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.41 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |