C18H20N2O2S — CID 46568360
N-[3-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]propanamide (PubChem CID 46568360) has the molecular formula C18H20N2O2S and a molecular weight of 328.44 g/mol. Its IUPAC name is N-[3-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]propanamide.
| Compound Name | N-[3-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]propanamide |
|---|---|
| PubChem CID | 46568360 |
| Molecular Formula | C18H20N2O2S |
| Molecular Weight | 328.44 g/mol |
| Exact Mass | 328.12 |
| IUPAC Name | N-[3-[[2-(4-methylphenyl)sulfanylacetyl]amino]phenyl]propanamide |
| SMILES | CCC(=O)Nc1cccc(NC(=O)CSc2ccc(C)cc2)c1 |
| InChI | InChI=1S/C18H20N2O2S/c1-3-17(21)19-14-5-4-6-15(11-14)20-18(22)12-23-16-9-7-13(2)8-10-16/h4-11H,3,12H2,1-2H3,(H,19,21)(H,20,22) |
| InChIKey | FMCYLEKLXUJSKJ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.44 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |