C16H16ClNOS — CID 126184527
N-(4-chloro-3-methylphenyl)-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 126184527) has the molecular formula C16H16ClNOS and a molecular weight of 305.83 g/mol. Its IUPAC name is N-(4-chloro-3-methylphenyl)-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-(4-chloro-3-methylphenyl)-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 126184527 |
| Molecular Formula | C16H16ClNOS |
| Molecular Weight | 305.83 g/mol |
| Exact Mass | 305.06 |
| IUPAC Name | N-(4-chloro-3-methylphenyl)-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)Nc2ccc(Cl)c(C)c2)cc1 |
| InChI | InChI=1S/C16H16ClNOS/c1-11-3-6-14(7-4-11)20-10-16(19)18-13-5-8-15(17)12(2)9-13/h3-9H,10H2,1-2H3,(H,18,19) |
| InChIKey | FWNMIHCLOJBGOG-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.83 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |