C23H17NO3S — CID 7545109
N-(9,10-dioxoanthracen-2-yl)-2-(4-methylphenyl)sulfanylacetamide (PubChem CID 7545109) has the molecular formula C23H17NO3S and a molecular weight of 387.46 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)-2-(4-methylphenyl)sulfanylacetamide.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-methylphenyl)sulfanylacetamide |
|---|---|
| PubChem CID | 7545109 |
| Molecular Formula | C23H17NO3S |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.09 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)-2-(4-methylphenyl)sulfanylacetamide |
| SMILES | Cc1ccc(SCC(=O)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C23H17NO3S/c1-14-6-9-16(10-7-14)28-13-21(25)24-15-8-11-19-20(12-15)23(27)18-5-3-2-4-17(18)22(19)26/h2-12H,13H2,1H3,(H,24,25) |
| InChIKey | QTDGLHCLLWQIQV-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|