C22H16N2O2S — CID 118133668
1-(9,10-dioxoanthracen-2-yl)-3-(4-methylphenyl)thiourea (PubChem CID 118133668) has the molecular formula C22H16N2O2S and a molecular weight of 372.45 g/mol. Its IUPAC name is 1-(9,10-dioxoanthracen-2-yl)-3-(4-methylphenyl)thiourea.
| Compound Name | 1-(9,10-dioxoanthracen-2-yl)-3-(4-methylphenyl)thiourea |
|---|---|
| PubChem CID | 118133668 |
| Molecular Formula | C22H16N2O2S |
| Molecular Weight | 372.45 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 1-(9,10-dioxoanthracen-2-yl)-3-(4-methylphenyl)thiourea |
| SMILES | Cc1ccc(NC(=S)Nc2ccc3c(c2)C(=O)c2ccccc2C3=O)cc1 |
| InChI | InChI=1S/C22H16N2O2S/c1-13-6-8-14(9-7-13)23-22(27)24-15-10-11-18-19(12-15)21(26)17-5-3-2-4-16(17)20(18)25/h2-12H,1H3,(H2,23,24,27) |
| InChIKey | GIUWNKAULMLTMS-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.45 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|