C18H17NO3 — CID 143974024
N-(9,10-dioxoanthracen-2-yl)acetamide;ethane (PubChem CID 143974024) has the molecular formula C18H17NO3 and a molecular weight of 295.34 g/mol. Its IUPAC name is N-(9,10-dioxoanthracen-2-yl)acetamide;ethane.
| Compound Name | N-(9,10-dioxoanthracen-2-yl)acetamide;ethane |
|---|---|
| PubChem CID | 143974024 |
| Molecular Formula | C18H17NO3 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.12 |
| IUPAC Name | N-(9,10-dioxoanthracen-2-yl)acetamide;ethane |
| SMILES | CC.CC(=O)Nc1ccc2c(c1)C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C16H11NO3.C2H6/c1-9(18)17-10-6-7-13-14(8-10)16(20)12-5-3-2-4-11(12)15(13)19;1-2/h2-8H,1H3,(H,17,18);1-2H3 |
| InChIKey | PUCKDOUGNAJWBG-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|