C12H9NO5 — CID 135839434
N-(6,7-dihydroxy-5,8-dioxonaphthalen-2-yl)acetamide (PubChem CID 135839434) has the molecular formula C12H9NO5 and a molecular weight of 247.21 g/mol. Its IUPAC name is N-(6,7-dihydroxy-5,8-dioxonaphthalen-2-yl)acetamide.
| Compound Name | N-(6,7-dihydroxy-5,8-dioxonaphthalen-2-yl)acetamide |
|---|---|
| PubChem CID | 135839434 |
| Molecular Formula | C12H9NO5 |
| Molecular Weight | 247.21 g/mol |
| Exact Mass | 247.05 |
| IUPAC Name | N-(6,7-dihydroxy-5,8-dioxonaphthalen-2-yl)acetamide |
| SMILES | CC(=O)Nc1ccc2c(c1)C(=O)C(O)=C(O)C2=O |
| InChI | InChI=1S/C12H9NO5/c1-5(14)13-6-2-3-7-8(4-6)10(16)12(18)11(17)9(7)15/h2-4,17-18H,1H3,(H,13,14) |
| InChIKey | LXEDRQURNKKALD-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.21 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|