C26H34I2N4O4 — CID 10771147
[3-[[9,10-dioxo-6-[3-(trimethylazaniumyl)propanoylamino]anthracen-2-yl]amino]-3-oxopropyl]-trimethylazanium diiodide (PubChem CID 10771147) has the molecular formula C26H34I2N4O4 and a molecular weight of 720.39 g/mol. Its IUPAC name is [3-[[9,10-dioxo-6-[3-(trimethylazaniumyl)propanoylamino]anthracen-2-yl]amino]-3-oxopropyl]-trimethylazanium diiodide.
| Compound Name | [3-[[9,10-dioxo-6-[3-(trimethylazaniumyl)propanoylamino]anthracen-2-yl]amino]-3-oxopropyl]-trimethylazanium diiodide |
|---|---|
| PubChem CID | 10771147 |
| Molecular Formula | C26H34I2N4O4 |
| Molecular Weight | 720.39 g/mol |
| Exact Mass | 720.07 |
| IUPAC Name | [3-[[9,10-dioxo-6-[3-(trimethylazaniumyl)propanoylamino]anthracen-2-yl]amino]-3-oxopropyl]-trimethylazanium diiodide |
| SMILES | C[N+](C)(C)CCC(=O)Nc1ccc2c(c1)C(=O)c1ccc(NC(=O)CC[N+](C)(C)C)cc1C2=O.[I-].[I-] |
| InChI | InChI=1S/C26H32N4O4.2HI/c1-29(2,3)13-11-23(31)27-17-7-9-19-21(15-17)25(33)20-10-8-18(16-22(20)26(19)34)28-24(32)12-14-30(4,5)6;;/h7-10,15-16H,11-14H2,1-6H3;2*1H |
| InChIKey | AJROAWPPFNRFMG-UHFFFAOYSA-N |
| XLogP | -3.46 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.39 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|