C30H42I2N4O4 — CID 10842930
[3-[[7-[3-[diethyl(methyl)azaniumyl]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]-diethyl-methylazanium diiodide (PubChem CID 10842930) has the molecular formula C30H42I2N4O4 and a molecular weight of 776.50 g/mol. Its IUPAC name is [3-[[7-[3-[diethyl(methyl)azaniumyl]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]-diethyl-methylazanium diiodide.
| Compound Name | [3-[[7-[3-[diethyl(methyl)azaniumyl]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]-diethyl-methylazanium diiodide |
|---|---|
| PubChem CID | 10842930 |
| Molecular Formula | C30H42I2N4O4 |
| Molecular Weight | 776.50 g/mol |
| Exact Mass | 776.13 |
| IUPAC Name | [3-[[7-[3-[diethyl(methyl)azaniumyl]propanoylamino]-9,10-dioxoanthracen-2-yl]amino]-3-oxopropyl]-diethyl-methylazanium diiodide |
| SMILES | CC[N+](C)(CC)CCC(=O)Nc1ccc2c(c1)C(=O)c1cc(NC(=O)CC[N+](C)(CC)CC)ccc1C2=O.[I-].[I-] |
| InChI | InChI=1S/C30H40N4O4.2HI/c1-7-33(5,8-2)17-15-27(35)31-21-11-13-23-25(19-21)30(38)26-20-22(12-14-24(26)29(23)37)32-28(36)16-18-34(6,9-3)10-4;;/h11-14,19-20H,7-10,15-18H2,1-6H3;2*1H |
| InChIKey | XYFFAGXVIRERFN-UHFFFAOYSA-N |
| XLogP | -1.90 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 776.50 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|