C36H52N4O4 — CID 54263970
3-(dibutylamino)-N-[6-[3-(dibutylamino)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide (PubChem CID 54263970) has the molecular formula C36H52N4O4 and a molecular weight of 604.84 g/mol. Its IUPAC name is 3-(dibutylamino)-N-[6-[3-(dibutylamino)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide.
| Compound Name | 3-(dibutylamino)-N-[6-[3-(dibutylamino)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide |
|---|---|
| PubChem CID | 54263970 |
| Molecular Formula | C36H52N4O4 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | 3-(dibutylamino)-N-[6-[3-(dibutylamino)propanoylamino]-9,10-dioxoanthracen-2-yl]propanamide |
| SMILES | CCCCN(CCCC)CCC(=O)Nc1ccc2c(c1)C(=O)c1ccc(NC(=O)CCN(CCCC)CCCC)cc1C2=O |
| InChI | InChI=1S/C36H52N4O4/c1-5-9-19-39(20-10-6-2)23-17-33(41)37-27-13-15-29-31(25-27)35(43)30-16-14-28(26-32(30)36(29)44)38-34(42)18-24-40(21-11-7-3)22-12-8-4/h13-16,25-26H,5-12,17-24H2,1-4H3,(H,37,41)(H,38,42) |
| InChIKey | RFLKRRDDHCCNSU-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|