C14H20F2N2O — CID 2167939
3-[butyl(methyl)amino]-N-(3,4-difluorophenyl)propanamide (PubChem CID 2167939) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-N-(3,4-difluorophenyl)propanamide.
| Compound Name | 3-[butyl(methyl)amino]-N-(3,4-difluorophenyl)propanamide |
|---|---|
| PubChem CID | 2167939 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 3-[butyl(methyl)amino]-N-(3,4-difluorophenyl)propanamide |
| SMILES | CCCCN(C)CCC(=O)Nc1ccc(F)c(F)c1 |
| InChI | InChI=1S/C14H20F2N2O/c1-3-4-8-18(2)9-7-14(19)17-11-5-6-12(15)13(16)10-11/h5-6,10H,3-4,7-9H2,1-2H3,(H,17,19) |
| InChIKey | JTRJXEXEOKPQBR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |