C17H26N2O5 — CID 171154464
3-[butyl(methyl)amino]-N-(4-methylphenyl)propanamide;oxalic acid (PubChem CID 171154464) has the molecular formula C17H26N2O5 and a molecular weight of 338.40 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-N-(4-methylphenyl)propanamide;oxalic acid.
| Compound Name | 3-[butyl(methyl)amino]-N-(4-methylphenyl)propanamide;oxalic acid |
|---|---|
| PubChem CID | 171154464 |
| Molecular Formula | C17H26N2O5 |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.18 |
| IUPAC Name | 3-[butyl(methyl)amino]-N-(4-methylphenyl)propanamide;oxalic acid |
| SMILES | CCCCN(C)CCC(=O)Nc1ccc(C)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C15H24N2O.C2H2O4/c1-4-5-11-17(3)12-10-15(18)16-14-8-6-13(2)7-9-14;3-1(4)2(5)6/h6-9H,4-5,10-12H2,1-3H3,(H,16,18);(H,3,4)(H,5,6) |
| InChIKey | QCZSHYVMZIKMAD-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|