C35H56N4O2 — CID 139954498
3-[heptyl(methyl)amino]-N-[4-[[4-[3-[heptyl(methyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide (PubChem CID 139954498) has the molecular formula C35H56N4O2 and a molecular weight of 564.86 g/mol. Its IUPAC name is 3-[heptyl(methyl)amino]-N-[4-[[4-[3-[heptyl(methyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide.
| Compound Name | 3-[heptyl(methyl)amino]-N-[4-[[4-[3-[heptyl(methyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide |
|---|---|
| PubChem CID | 139954498 |
| Molecular Formula | C35H56N4O2 |
| Molecular Weight | 564.86 g/mol |
| Exact Mass | 564.44 |
| IUPAC Name | 3-[heptyl(methyl)amino]-N-[4-[[4-[3-[heptyl(methyl)amino]propanoylamino]phenyl]methyl]phenyl]propanamide |
| SMILES | CCCCCCCN(C)CCC(=O)Nc1ccc(Cc2ccc(NC(=O)CCN(C)CCCCCCC)cc2)cc1 |
| InChI | InChI=1S/C35H56N4O2/c1-5-7-9-11-13-25-38(3)27-23-34(40)36-32-19-15-30(16-20-32)29-31-17-21-33(22-18-31)37-35(41)24-28-39(4)26-14-12-10-8-6-2/h15-22H,5-14,23-29H2,1-4H3,(H,36,40)(H,37,41) |
| InChIKey | POQQANTVADOPOX-UHFFFAOYSA-N |
| XLogP | 7.74 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.86 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|