C16H23FN2O5 — CID 171154590
3-[butyl(methyl)amino]-N-(4-fluorophenyl)propanamide;oxalic acid (PubChem CID 171154590) has the molecular formula C16H23FN2O5 and a molecular weight of 342.37 g/mol. Its IUPAC name is 3-[butyl(methyl)amino]-N-(4-fluorophenyl)propanamide;oxalic acid.
| Compound Name | 3-[butyl(methyl)amino]-N-(4-fluorophenyl)propanamide;oxalic acid |
|---|---|
| PubChem CID | 171154590 |
| Molecular Formula | C16H23FN2O5 |
| Molecular Weight | 342.37 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 3-[butyl(methyl)amino]-N-(4-fluorophenyl)propanamide;oxalic acid |
| SMILES | CCCCN(C)CCC(=O)Nc1ccc(F)cc1.O=C(O)C(=O)O |
| InChI | InChI=1S/C14H21FN2O.C2H2O4/c1-3-4-10-17(2)11-9-14(18)16-13-7-5-12(15)6-8-13;3-1(4)2(5)6/h5-8H,3-4,9-11H2,1-2H3,(H,16,18);(H,3,4)(H,5,6) |
| InChIKey | XPTRURRTOGHRLE-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 106.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.37 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|