C15H23FN2O3S — CID 113141326
N-(4-fluorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide (PubChem CID 113141326) has the molecular formula C15H23FN2O3S and a molecular weight of 330.42 g/mol. Its IUPAC name is N-(4-fluorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide.
| Compound Name | N-(4-fluorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide |
|---|---|
| PubChem CID | 113141326 |
| Molecular Formula | C15H23FN2O3S |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.14 |
| IUPAC Name | N-(4-fluorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide |
| SMILES | CCCCCN(CCC(=O)Nc1ccc(F)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C15H23FN2O3S/c1-3-4-5-11-18(22(2,20)21)12-10-15(19)17-14-8-6-13(16)7-9-14/h6-9H,3-5,10-12H2,1-2H3,(H,17,19) |
| InChIKey | ZWGXKIQRVDBVPK-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|