C17H28N2O3S — CID 113141316
N-(4-ethylphenyl)-3-[methylsulfonyl(pentyl)amino]propanamide (PubChem CID 113141316) has the molecular formula C17H28N2O3S and a molecular weight of 340.49 g/mol. Its IUPAC name is N-(4-ethylphenyl)-3-[methylsulfonyl(pentyl)amino]propanamide.
| Compound Name | N-(4-ethylphenyl)-3-[methylsulfonyl(pentyl)amino]propanamide |
|---|---|
| PubChem CID | 113141316 |
| Molecular Formula | C17H28N2O3S |
| Molecular Weight | 340.49 g/mol |
| Exact Mass | 340.18 |
| IUPAC Name | N-(4-ethylphenyl)-3-[methylsulfonyl(pentyl)amino]propanamide |
| SMILES | CCCCCN(CCC(=O)Nc1ccc(CC)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C17H28N2O3S/c1-4-6-7-13-19(23(3,21)22)14-12-17(20)18-16-10-8-15(5-2)9-11-16/h8-11H,4-7,12-14H2,1-3H3,(H,18,20) |
| InChIKey | SGPISNPMSCMSIB-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.49 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|