C15H22Cl2N2O3S — CID 113141365
N-(3,5-dichlorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide (PubChem CID 113141365) has the molecular formula C15H22Cl2N2O3S and a molecular weight of 381.33 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide.
| Compound Name | N-(3,5-dichlorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide |
|---|---|
| PubChem CID | 113141365 |
| Molecular Formula | C15H22Cl2N2O3S |
| Molecular Weight | 381.33 g/mol |
| Exact Mass | 380.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-3-[methylsulfonyl(pentyl)amino]propanamide |
| SMILES | CCCCCN(CCC(=O)Nc1cc(Cl)cc(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C15H22Cl2N2O3S/c1-3-4-5-7-19(23(2,21)22)8-6-15(20)18-14-10-12(16)9-13(17)11-14/h9-11H,3-8H2,1-2H3,(H,18,20) |
| InChIKey | VDOSCXAZBKWSLD-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.33 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|